C32H43N3O9 — CID 54697398
(4S,5S,6R,12aR)-9-(decanoylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54697398) has the molecular formula C32H43N3O9 and a molecular weight of 613.71 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-9-(decanoylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-9-(decanoylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54697398 |
| Molecular Formula | C32H43N3O9 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | (4S,5S,6R,12aR)-9-(decanoylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C1[C@H]2C |
| InChI | InChI=1S/C32H43N3O9/c1-5-6-7-8-9-10-11-12-18(36)34-17-14-13-16-15(2)19-21(26(38)20(16)25(17)37)29(41)32(44)23(27(19)39)24(35(3)4)28(40)22(30(32)42)31(33)43/h13-15,19,23-24,27,37-39,42,44H,5-12H2,1-4H3,(H2,33,43)(H,34,36)/t15-,19?,23?,24-,27?,32-/m0/s1 |
| InChIKey | DUUXCSPGACVPFR-YWYNDDLISA-N |
| XLogP | 2.58 |
| TPSA | 210.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|