About zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine
zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine (PubChem CID 54697498) has the molecular formula C24H24N2O6Zn
and a molecular weight of 501.85 g/mol. Its IUPAC name is zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine.
Molecular Properties
| Compound Name | zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine |
| PubChem CID | 54697498 |
| Molecular Formula | C24H24N2O6Zn |
| Molecular Weight | 501.85 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine |
| SMILES | CN1CCCC1c1cccnc1.O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Zn+2] |
| InChI | InChI=1S/C10H14N2.2C7H6O3.Zn/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2*8-6-4-2-1-3-5(6)7(9)10;/h2,4,6,8,10H,3,5,7H2,1H3;2*1-4,8H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | ZSHLNUSDCXMDQM-UHFFFAOYSA-L |
| XLogP | 2.76 |
| TPSA | 136.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine?
The IUPAC name of zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine (CID 54697498) is zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine.
What is the SMILES notation for zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine?
The canonical SMILES for zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine is CN1CCCC1c1cccnc1.O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Zn+2].
What is the InChIKey of zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine?
The InChIKey is ZSHLNUSDCXMDQM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H14N2.2C7H6O3.Zn/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2*8-6-4-2-1-3-5(6)7(9)10;/h2,4,6,8,10H,3,5,7H2,1H3;2*1-4,8H,(H,9,10);/q;;;+2/p-2.
What are the key properties of zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine?
zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine has a molecular weight of 501.85 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;bis(2-carboxyphenolate);3-(1-methylpyrrolidin-2-yl)pyridine is sourced from PubChem (CID 54697498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).