C21H23NO5 — CID 54697562
4-hydroxy-3-[(2E,4E)-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one (PubChem CID 54697562) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-hydroxy-3-[(2E,4E)-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one.
| Compound Name | 4-hydroxy-3-[(2E,4E)-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 54697562 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-hydroxy-3-[(2E,4E)-6-(hydroxymethyl)-4-methylocta-2,4-dienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES | CCC(/C=C(C)/C=C/C(=O)c1c(O)c(-c2ccc(O)cc2)c[nH]c1=O)CO |
| InChI | InChI=1S/C21H23NO5/c1-3-14(12-23)10-13(2)4-9-18(25)19-20(26)17(11-22-21(19)27)15-5-7-16(24)8-6-15/h4-11,14,23-24H,3,12H2,1-2H3,(H2,22,26,27)/b9-4+,13-10+ |
| InChIKey | RZNMCGWGYUMEOL-HTKXOECOSA-N |
| XLogP | 3.16 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|