About azanium 2-carboxyphenolate
azanium 2-carboxyphenolate (PubChem CID 54697583) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is azanium 2-carboxyphenolate.
Molecular Properties
| Compound Name | azanium 2-carboxyphenolate |
| PubChem CID | 54697583 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | azanium 2-carboxyphenolate |
| SMILES | O=C(O)c1ccccc1[O-].[NH4+] |
| InChI | InChI=1S/C7H6O3.H3N/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);1H3 |
| InChIKey | BOFZOTMTKBQRAB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium 2-carboxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-carboxyphenolate?
The IUPAC name of azanium 2-carboxyphenolate (CID 54697583) is azanium 2-carboxyphenolate.
What is the SMILES notation for azanium 2-carboxyphenolate?
The canonical SMILES for azanium 2-carboxyphenolate is O=C(O)c1ccccc1[O-].[NH4+].
What is the InChIKey of azanium 2-carboxyphenolate?
The InChIKey is BOFZOTMTKBQRAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.H3N/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);1H3.
What are the key properties of azanium 2-carboxyphenolate?
azanium 2-carboxyphenolate has a molecular weight of 155.15 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-carboxyphenolate is sourced from PubChem (CID 54697583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).