About magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate
magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate (PubChem CID 54697794) has the molecular formula C6H7MgO9P
and a molecular weight of 278.39 g/mol. Its IUPAC name is magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate.
Molecular Properties
| Compound Name | magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate |
| PubChem CID | 54697794 |
| Molecular Formula | C6H7MgO9P |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate |
| SMILES | O=C1OC(C(O)COP(=O)([O-])[O-])C(O)=C1O.[Mg+2] |
| InChI | InChI=1S/C6H9O9P.Mg/c7-2(1-14-16(11,12)13)5-3(8)4(9)6(10)15-5;/h2,5,7-9H,1H2,(H2,11,12,13);/q;+2/p-2 |
| InChIKey | WRBOSFAEKUWLTJ-UHFFFAOYSA-L |
| XLogP | -2.94 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate?
The IUPAC name of magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate (CID 54697794) is magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate.
What is the SMILES notation for magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate?
The canonical SMILES for magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate is O=C1OC(C(O)COP(=O)([O-])[O-])C(O)=C1O.[Mg+2].
What is the InChIKey of magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate?
The InChIKey is WRBOSFAEKUWLTJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H9O9P.Mg/c7-2(1-14-16(11,12)13)5-3(8)4(9)6(10)15-5;/h2,5,7-9H,1H2,(H2,11,12,13);/q;+2/p-2.
What are the key properties of magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate?
magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate has a molecular weight of 278.39 g/mol, XLogP of -2.94, 4 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] phosphate is sourced from PubChem (CID 54697794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).