C22H16IN2O4+ — CID 54697993
[4-hydroxy-1-(3-methoxycarbonylphenyl)-2-oxo-1,8-naphthyridin-3-yl]-phenyliodanium (PubChem CID 54697993) has the molecular formula C22H16IN2O4+ and a molecular weight of 499.28 g/mol. Its IUPAC name is [4-hydroxy-1-(3-methoxycarbonylphenyl)-2-oxo-1,8-naphthyridin-3-yl]-phenyliodanium.
| Compound Name | [4-hydroxy-1-(3-methoxycarbonylphenyl)-2-oxo-1,8-naphthyridin-3-yl]-phenyliodanium |
|---|---|
| PubChem CID | 54697993 |
| Molecular Formula | C22H16IN2O4+ |
| Molecular Weight | 499.28 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | [4-hydroxy-1-(3-methoxycarbonylphenyl)-2-oxo-1,8-naphthyridin-3-yl]-phenyliodanium |
| SMILES | COC(=O)c1cccc(-n2c(=O)c([I+]c3ccccc3)c(O)c3cccnc32)c1 |
| InChI | InChI=1S/C22H15IN2O4/c1-29-22(28)14-7-5-10-16(13-14)25-20-17(11-6-12-24-20)19(26)18(21(25)27)23-15-8-3-2-4-9-15/h2-13H,1H3/p+1 |
| InChIKey | SLUPTBOPAWQBAL-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|