About (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane
(3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane (PubChem CID 5469804) has the molecular formula C10H14BrCl3
and a molecular weight of 320.49 g/mol. Its IUPAC name is (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane.
Molecular Properties
| Compound Name | (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane |
| PubChem CID | 5469804 |
| Molecular Formula | C10H14BrCl3 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane |
| SMILES | CC1(C)C(Cl)CC(Br)/C(=C\CCl)C1Cl |
| InChI | InChI=1S/C10H14BrCl3/c1-10(2)8(13)5-7(11)6(3-4-12)9(10)14/h3,7-9H,4-5H2,1-2H3/b6-3+ |
| InChIKey | LYWCAYROTMXQAJ-ZZXKWVIFSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane?
The IUPAC name of (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane (CID 5469804) is (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane.
What is the SMILES notation for (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane?
The canonical SMILES for (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane is CC1(C)C(Cl)CC(Br)/C(=C\CCl)C1Cl.
What is the InChIKey of (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane?
The InChIKey is LYWCAYROTMXQAJ-ZZXKWVIFSA-N. The full InChI is InChI=1S/C10H14BrCl3/c1-10(2)8(13)5-7(11)6(3-4-12)9(10)14/h3,7-9H,4-5H2,1-2H3/b6-3+.
What are the key properties of (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane?
(3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane has a molecular weight of 320.49 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-bromo-2,6-dichloro-3-(2-chloroethylidene)-1,1-dimethylcyclohexane is sourced from PubChem (CID 5469804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).