C32H46O3 — CID 5469810
(8S,16Z,28E,30R)-dotriaconta-16,28-dien-2,4,6,31-tetrayne-1,8,30-triol (PubChem CID 5469810) has the molecular formula C32H46O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is (8S,16Z,28E,30R)-dotriaconta-16,28-dien-2,4,6,31-tetrayne-1,8,30-triol.
| Compound Name | (8S,16Z,28E,30R)-dotriaconta-16,28-dien-2,4,6,31-tetrayne-1,8,30-triol |
|---|---|
| PubChem CID | 5469810 |
| Molecular Formula | C32H46O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | (8S,16Z,28E,30R)-dotriaconta-16,28-dien-2,4,6,31-tetrayne-1,8,30-triol |
| SMILES | C#C[C@H](O)/C=C/CCCCCCCCCC/C=C\CCCCCCC[C@H](O)C#CC#CC#CCO |
| InChI | InChI=1S/C32H46O3/c1-2-31(34)27-23-19-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20-24-28-32(35)29-25-21-18-22-26-30-33/h1,7,9,23,27,31-35H,3-6,8,10-17,19-20,24,28,30H2/b9-7-,27-23+/t31-,32-/m0/s1 |
| InChIKey | QTLSWJYHGFEXNL-FFUIAIKSSA-N |
| XLogP | 6.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|