C31H44O3 — CID 5469812
(8S,17Z,27E,29R)-hentriaconta-17,27-dien-2,4,6,30-tetrayne-1,8,29-triol (PubChem CID 5469812) has the molecular formula C31H44O3 and a molecular weight of 464.69 g/mol. Its IUPAC name is (8S,17Z,27E,29R)-hentriaconta-17,27-dien-2,4,6,30-tetrayne-1,8,29-triol.
| Compound Name | (8S,17Z,27E,29R)-hentriaconta-17,27-dien-2,4,6,30-tetrayne-1,8,29-triol |
|---|---|
| PubChem CID | 5469812 |
| Molecular Formula | C31H44O3 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (8S,17Z,27E,29R)-hentriaconta-17,27-dien-2,4,6,30-tetrayne-1,8,29-triol |
| SMILES | C#C[C@H](O)/C=C/CCCCCCCC/C=C\CCCCCCCC[C@H](O)C#CC#CC#CCO |
| InChI | InChI=1S/C31H44O3/c1-2-30(33)26-22-18-15-13-11-9-7-5-3-4-6-8-10-12-14-16-19-23-27-31(34)28-24-20-17-21-25-29-32/h1,4,6,22,26,30-34H,3,5,7-16,18-19,23,27,29H2/b6-4-,26-22+/t30-,31-/m0/s1 |
| InChIKey | RYOORYDDTFATPC-XOERQBCYSA-N |
| XLogP | 5.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|