C18H15N3O2S2 — CID 54698350
15-hydroxy-6-methyl-9-thiophen-2-yl-17-thia-2,6,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one (PubChem CID 54698350) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 15-hydroxy-6-methyl-9-thiophen-2-yl-17-thia-2,6,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one.
| Compound Name | 15-hydroxy-6-methyl-9-thiophen-2-yl-17-thia-2,6,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one |
|---|---|
| PubChem CID | 54698350 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 15-hydroxy-6-methyl-9-thiophen-2-yl-17-thia-2,6,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one |
| SMILES | CN1CCc2nc3sc4c(O)cc(=O)[nH]c4c3c(-c3cccs3)c2C1 |
| InChI | InChI=1S/C18H15N3O2S2/c1-21-5-4-10-9(8-21)14(12-3-2-6-24-12)15-16-17(25-18(15)19-10)11(22)7-13(23)20-16/h2-3,6-7H,4-5,8H2,1H3,(H2,20,22,23) |
| InChIKey | PRMOEMKPSHONTQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |