C14H24O5 — CID 5469853
(Z)-4-(2,2-dimethyl-1,3-dioxan-5-yl)-1-(2-methyl-1,3-dioxolan-2-yl)but-3-en-2-ol (PubChem CID 5469853) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (Z)-4-(2,2-dimethyl-1,3-dioxan-5-yl)-1-(2-methyl-1,3-dioxolan-2-yl)but-3-en-2-ol.
| Compound Name | (Z)-4-(2,2-dimethyl-1,3-dioxan-5-yl)-1-(2-methyl-1,3-dioxolan-2-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 5469853 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (Z)-4-(2,2-dimethyl-1,3-dioxan-5-yl)-1-(2-methyl-1,3-dioxolan-2-yl)but-3-en-2-ol |
| SMILES | CC1(C)OCC(/C=C\C(O)CC2(C)OCCO2)CO1 |
| InChI | InChI=1S/C14H24O5/c1-13(2)18-9-11(10-19-13)4-5-12(15)8-14(3)16-6-7-17-14/h4-5,11-12,15H,6-10H2,1-3H3/b5-4- |
| InChIKey | TYVJEJZYENCTEN-PLNGDYQASA-N |
| XLogP | 1.46 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|