C61H56N4O6 — CID 54699051
3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate;bis(4-(1,6-dimethylquinolin-1-ium-2-yl)-N,N-dimethylaniline) (PubChem CID 54699051) has the molecular formula C61H56N4O6 and a molecular weight of 941.14 g/mol. Its IUPAC name is 3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate;bis(4-(1,6-dimethylquinolin-1-ium-2-yl)-N,N-dimethylaniline).
| Compound Name | 3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate;bis(4-(1,6-dimethylquinolin-1-ium-2-yl)-N,N-dimethylaniline) |
|---|---|
| PubChem CID | 54699051 |
| Molecular Formula | C61H56N4O6 |
| Molecular Weight | 941.14 g/mol |
| Exact Mass | 940.42 |
| IUPAC Name | 3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate;bis(4-(1,6-dimethylquinolin-1-ium-2-yl)-N,N-dimethylaniline) |
| SMILES | Cc1ccc2c(ccc(-c3ccc(N(C)C)cc3)[n+]2C)c1.Cc1ccc2c(ccc(-c3ccc(N(C)C)cc3)[n+]2C)c1.O=C(O)c1cc2ccccc2c(Cc2c([O-])c(C(=O)O)cc3ccccc23)c1[O-] |
| InChI | InChI=1S/C23H16O6.2C19H21N2/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;2*1-14-5-11-19-16(13-14)8-12-18(21(19)4)15-6-9-17(10-7-15)20(2)3/h1-10,24-25H,11H2,(H,26,27)(H,28,29);2*5-13H,1-4H3/q;2*+1/p-2 |
| InChIKey | PCXBADRHMZSHCN-UHFFFAOYSA-L |
| XLogP | 10.54 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.14 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|