C20H32O2 — CID 5469908
(1R,2E,5E,9E,13S)-13-(3-hydroxyprop-1-en-2-yl)-2,6,10-trimethylcyclotetradeca-2,5,9-trien-1-ol (PubChem CID 5469908) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,2E,5E,9E,13S)-13-(3-hydroxyprop-1-en-2-yl)-2,6,10-trimethylcyclotetradeca-2,5,9-trien-1-ol.
| Compound Name | (1R,2E,5E,9E,13S)-13-(3-hydroxyprop-1-en-2-yl)-2,6,10-trimethylcyclotetradeca-2,5,9-trien-1-ol |
|---|---|
| PubChem CID | 5469908 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,2E,5E,9E,13S)-13-(3-hydroxyprop-1-en-2-yl)-2,6,10-trimethylcyclotetradeca-2,5,9-trien-1-ol |
| SMILES | C=C(CO)[C@H]1CC/C(C)=C/CC/C(C)=C/C/C=C(\C)[C@H](O)C1 |
| InChI | InChI=1S/C20H32O2/c1-15-7-5-8-16(2)11-12-19(18(4)14-21)13-20(22)17(3)10-6-9-15/h8-10,19-22H,4-7,11-14H2,1-3H3/b15-9+,16-8+,17-10+/t19-,20+/m0/s1 |
| InChIKey | LVXDRCSHBHXOGT-ZVRPMZRQSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|