C36H42N4O8 — CID 54699280
N-[[9-carbamoyl-4-(2-cyclohexylethyl)-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 54699280) has the molecular formula C36H42N4O8 and a molecular weight of 658.75 g/mol. Its IUPAC name is N-[[9-carbamoyl-4-(2-cyclohexylethyl)-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[9-carbamoyl-4-(2-cyclohexylethyl)-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54699280 |
| Molecular Formula | C36H42N4O8 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | N-[[9-carbamoyl-4-(2-cyclohexylethyl)-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(CNC(=O)c5cccnc5)cc(CCC5CCCCC5)c4CC3CC12 |
| InChI | InChI=1S/C36H42N4O8/c1-40(2)28-24-15-21-14-23-19(11-10-18-7-4-3-5-8-18)13-22(17-39-35(47)20-9-6-12-38-16-20)29(41)26(23)30(42)25(21)32(44)36(24,48)33(45)27(31(28)43)34(37)46/h6,9,12-13,16,18,21,24,28,41-42,45,48H,3-5,7-8,10-11,14-15,17H2,1-2H3,(H2,37,46)(H,39,47) |
| InChIKey | NCJBXMOAWCHUSY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 203.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|