C25H29N3O6 — CID 54699330
(4S,12aR)-4-(dimethylamino)-1,11,12a-trihydroxy-3,12-dioxo-10-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54699330) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-1,11,12a-trihydroxy-3,12-dioxo-10-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-1,11,12a-trihydroxy-3,12-dioxo-10-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54699330 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-1,11,12a-trihydroxy-3,12-dioxo-10-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cccc4N4CCCC4)CC3CC12 |
| InChI | InChI=1S/C25H29N3O6/c1-27(2)19-14-11-13-10-12-6-5-7-15(28-8-3-4-9-28)16(12)20(29)17(13)22(31)25(14,34)23(32)18(21(19)30)24(26)33/h5-7,13-14,19,29,32,34H,3-4,8-11H2,1-2H3,(H2,26,33)/t13?,14?,19-,25-/m0/s1 |
| InChIKey | KGMPQVJRBIOWOH-DSQMCTLISA-N |
| XLogP | 0.86 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|