C19H19Cl2NO5 — CID 54699379
3-[(6,7-dichloro-2-cyclopentyl-1-hydroxy-2-methyl-1,3-dihydroinden-5-yl)oxy]-4-hydroxypyrrole-2,5-dione (PubChem CID 54699379) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is 3-[(6,7-dichloro-2-cyclopentyl-1-hydroxy-2-methyl-1,3-dihydroinden-5-yl)oxy]-4-hydroxypyrrole-2,5-dione.
| Compound Name | 3-[(6,7-dichloro-2-cyclopentyl-1-hydroxy-2-methyl-1,3-dihydroinden-5-yl)oxy]-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 54699379 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 3-[(6,7-dichloro-2-cyclopentyl-1-hydroxy-2-methyl-1,3-dihydroinden-5-yl)oxy]-4-hydroxypyrrole-2,5-dione |
| SMILES | CC1(C2CCCC2)Cc2cc(OC3=C(O)C(=O)NC3=O)c(Cl)c(Cl)c2C1O |
| InChI | InChI=1S/C19H19Cl2NO5/c1-19(9-4-2-3-5-9)7-8-6-10(12(20)13(21)11(8)16(19)24)27-15-14(23)17(25)22-18(15)26/h6,9,16,24H,2-5,7H2,1H3,(H2,22,23,25,26) |
| InChIKey | FOJUCYBBHQNLGO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|