About (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene
(Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene (PubChem CID 5469951) has the molecular formula C10H15BrO2
and a molecular weight of 247.13 g/mol. Its IUPAC name is (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene.
Molecular Properties
| Compound Name | (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene |
| PubChem CID | 5469951 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene |
| SMILES | C=CCOC(OCC=C)/C(Br)=C/C |
| InChI | InChI=1S/C10H15BrO2/c1-4-7-12-10(9(11)6-3)13-8-5-2/h4-6,10H,1-2,7-8H2,3H3/b9-6- |
| InChIKey | HGZGFEKGYWBLPB-TWGQIWQCSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene?
The IUPAC name of (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene (CID 5469951) is (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene.
What is the SMILES notation for (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene?
The canonical SMILES for (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene is C=CCOC(OCC=C)/C(Br)=C/C.
What is the InChIKey of (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene?
The InChIKey is HGZGFEKGYWBLPB-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H15BrO2/c1-4-7-12-10(9(11)6-3)13-8-5-2/h4-6,10H,1-2,7-8H2,3H3/b9-6-.
What are the key properties of (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene?
(Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene has a molecular weight of 247.13 g/mol, XLogP of 3.02, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-bromo-1,1-bis(prop-2-enoxy)but-2-ene is sourced from PubChem (CID 5469951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).