C32H56N2 — CID 5469974
(6Z,12S,14S,21Z,29S,30S)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriaconta-6,21-diene (PubChem CID 5469974) has the molecular formula C32H56N2 and a molecular weight of 468.81 g/mol. Its IUPAC name is (6Z,12S,14S,21Z,29S,30S)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriaconta-6,21-diene.
| Compound Name | (6Z,12S,14S,21Z,29S,30S)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriaconta-6,21-diene |
|---|---|
| PubChem CID | 5469974 |
| Molecular Formula | C32H56N2 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.44 |
| IUPAC Name | (6Z,12S,14S,21Z,29S,30S)-1,16-diazatetracyclo[27.3.1.112,16.014,30]tetratriaconta-6,21-diene |
| SMILES | C1=C\CCCCN2C[C@H]3CCCC/C=C\CCCCN4CC[C@@H]([C@H](CCCCCC/1)C4)[C@H](C3)C2 |
| InChI | InChI=1S/C32H56N2/c1-2-5-10-14-18-23-34-26-29-19-15-11-7-4-6-9-13-17-22-33-24-21-32(31(25-29)28-34)30(27-33)20-16-12-8-3-1/h2,4-6,29-32H,1,3,7-28H2/b5-2-,6-4-/t29-,30+,31+,32-/m0/s1 |
| InChIKey | JANRLKRLOULGGB-MRYHGRHFSA-N |
| XLogP | 8.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|