C26H24Cl2N6O4 — CID 5470200
(1E,3Z)-1-(benzotriazol-1-yl)-3,4-dichloro-N,N'-bis(4-ethoxyphenyl)-2-nitrobuta-1,3-diene-1,4-diamine (PubChem CID 5470200) has the molecular formula C26H24Cl2N6O4 and a molecular weight of 555.42 g/mol. Its IUPAC name is (1E,3Z)-1-(benzotriazol-1-yl)-3,4-dichloro-N,N'-bis(4-ethoxyphenyl)-2-nitrobuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(benzotriazol-1-yl)-3,4-dichloro-N,N'-bis(4-ethoxyphenyl)-2-nitrobuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 5470200 |
| Molecular Formula | C26H24Cl2N6O4 |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | (1E,3Z)-1-(benzotriazol-1-yl)-3,4-dichloro-N,N'-bis(4-ethoxyphenyl)-2-nitrobuta-1,3-diene-1,4-diamine |
| SMILES | CCOc1ccc(N/C(Cl)=C(Cl)\C(=C(\Nc2ccc(OCC)cc2)n2nnc3ccccc32)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H24Cl2N6O4/c1-3-37-19-13-9-17(10-14-19)29-25(28)23(27)24(34(35)36)26(30-18-11-15-20(16-12-18)38-4-2)33-22-8-6-5-7-21(22)31-32-33/h5-16,29-30H,3-4H2,1-2H3/b25-23+,26-24+ |
| InChIKey | CEVMZZGRCDNQBT-OGGGYYITSA-N |
| XLogP | 6.50 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|