C20H20Cl2N6O4 — CID 5470201
2-[[(1Z,3E)-4-(benzotriazol-1-yl)-1,2-dichloro-4-(4-ethoxyanilino)-3-nitrobuta-1,3-dienyl]amino]ethanol (PubChem CID 5470201) has the molecular formula C20H20Cl2N6O4 and a molecular weight of 479.32 g/mol. Its IUPAC name is 2-[[(1Z,3E)-4-(benzotriazol-1-yl)-1,2-dichloro-4-(4-ethoxyanilino)-3-nitrobuta-1,3-dienyl]amino]ethanol.
| Compound Name | 2-[[(1Z,3E)-4-(benzotriazol-1-yl)-1,2-dichloro-4-(4-ethoxyanilino)-3-nitrobuta-1,3-dienyl]amino]ethanol |
|---|---|
| PubChem CID | 5470201 |
| Molecular Formula | C20H20Cl2N6O4 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[[(1Z,3E)-4-(benzotriazol-1-yl)-1,2-dichloro-4-(4-ethoxyanilino)-3-nitrobuta-1,3-dienyl]amino]ethanol |
| SMILES | CCOc1ccc(N/C(=C(C(/Cl)=C(/Cl)NCCO)\[N+](=O)[O-])n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C20H20Cl2N6O4/c1-2-32-14-9-7-13(8-10-14)24-20(27-16-6-4-3-5-15(16)25-26-27)18(28(30)31)17(21)19(22)23-11-12-29/h3-10,23-24,29H,2,11-12H2,1H3/b19-17+,20-18+ |
| InChIKey | BLEKUQRNIUGZQT-XPWSMXQVSA-N |
| XLogP | 3.57 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|