C20H21Cl2N7O3 — CID 5470202
(1Z,3E)-N-(2-aminoethyl)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitrobuta-1,3-diene-1,4-diamine (PubChem CID 5470202) has the molecular formula C20H21Cl2N7O3 and a molecular weight of 478.34 g/mol. Its IUPAC name is (1Z,3E)-N-(2-aminoethyl)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitrobuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3E)-N-(2-aminoethyl)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitrobuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 5470202 |
| Molecular Formula | C20H21Cl2N7O3 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | (1Z,3E)-N-(2-aminoethyl)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitrobuta-1,3-diene-1,4-diamine |
| SMILES | CCOc1ccc(N/C(=C(C(/Cl)=C(/Cl)NCCN)\[N+](=O)[O-])n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C20H21Cl2N7O3/c1-2-32-14-9-7-13(8-10-14)25-20(28-16-6-4-3-5-15(16)26-27-28)18(29(30)31)17(21)19(22)24-12-11-23/h3-10,24-25H,2,11-12,23H2,1H3/b19-17+,20-18+ |
| InChIKey | UKVFYPDFKHLLBP-XPWSMXQVSA-N |
| XLogP | 3.54 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|