sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate

C6H7NaO6 — CID 54702495

IUPACsodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate
SMILESO=C1OC(C(O)C[O-])C(O)=C1O.[Na+]
InChIInChI=1S/C6H7O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,8-10H,1H2;/q-1;+1
InChIKeyRBWSWDPRDBEWCR-UHFFFAOYSA-N
MW198.11 g/mol
LogP-5.04
Rot. Bonds2

About sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate

sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate (PubChem CID 54702495) has the molecular formula C6H7NaO6 and a molecular weight of 198.11 g/mol. Its IUPAC name is sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate.

Molecular Properties

Compound Namesodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate
PubChem CID54702495
Molecular FormulaC6H7NaO6
Molecular Weight198.11 g/mol
Exact Mass198.01
IUPAC Namesodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate
SMILESO=C1OC(C(O)C[O-])C(O)=C1O.[Na+]
InChIInChI=1S/C6H7O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,8-10H,1H2;/q-1;+1
InChIKeyRBWSWDPRDBEWCR-UHFFFAOYSA-N
XLogP-5.04
TPSA110.05 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.11
LogP ≤ 5-5.04
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate?
The IUPAC name of sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate (CID 54702495) is sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate.
What is the SMILES notation for sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate?
The canonical SMILES for sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate is O=C1OC(C(O)C[O-])C(O)=C1O.[Na+].
What is the InChIKey of sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate?
The InChIKey is RBWSWDPRDBEWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,8-10H,1H2;/q-1;+1.
What are the key properties of sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate?
sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate has a molecular weight of 198.11 g/mol, XLogP of -5.04, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethanolate is sourced from PubChem (CID 54702495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).