About 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one
4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one (PubChem CID 54702806) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one |
| PubChem CID | 54702806 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one |
| SMILES | Cc1c(O)c2cccnc2n(C)c1=O |
| InChI | InChI=1S/C10H10N2O2/c1-6-8(13)7-4-3-5-11-9(7)12(2)10(6)14/h3-5,13H,1-2H3 |
| InChIKey | PSOTXCURSMWJBP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one?
The IUPAC name of 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one (CID 54702806) is 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one.
What is the SMILES notation for 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one?
The canonical SMILES for 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one is Cc1c(O)c2cccnc2n(C)c1=O.
What is the InChIKey of 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one?
The InChIKey is PSOTXCURSMWJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-8(13)7-4-3-5-11-9(7)12(2)10(6)14/h3-5,13H,1-2H3.
What are the key properties of 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one?
4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one has a molecular weight of 190.20 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-dimethyl-1,8-naphthyridin-2-one is sourced from PubChem (CID 54702806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).