About 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol
2-carboxyphenolate;1-methylquinolin-1-ium-8-ol (PubChem CID 54702984) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol.
Molecular Properties
| Compound Name | 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol |
| PubChem CID | 54702984 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol |
| SMILES | C[n+]1cccc2cccc(O)c21.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C10H9NO.C7H6O3/c1-11-7-3-5-8-4-2-6-9(12)10(8)11;8-6-4-2-1-3-5(6)7(9)10/h2-7H,1H3;1-4,8H,(H,9,10) |
| InChIKey | QNGMRDRNTNQCCH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol?
The IUPAC name of 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol (CID 54702984) is 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol.
What is the SMILES notation for 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol?
The canonical SMILES for 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol is C[n+]1cccc2cccc(O)c21.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol?
The InChIKey is QNGMRDRNTNQCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C7H6O3/c1-11-7-3-5-8-4-2-6-9(12)10(8)11;8-6-4-2-1-3-5(6)7(9)10/h2-7H,1H3;1-4,8H,(H,9,10).
What are the key properties of 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol?
2-carboxyphenolate;1-methylquinolin-1-ium-8-ol has a molecular weight of 297.31 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;1-methylquinolin-1-ium-8-ol is sourced from PubChem (CID 54702984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).