About 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate
1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 54703006) has the molecular formula C10H12O6
and a molecular weight of 228.20 g/mol. Its IUPAC name is dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate.
Analyze 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate?
The IUPAC name of 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate (CID 54703006) is dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate.
What is the SMILES notation for 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate?
The canonical SMILES for 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate is COC(=O)C1=C(CC(=C(C1)O)C(=O)OC)O.
What is the InChIKey of 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate?
The InChIKey is XZBODPPGVQZFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h11-12H,3-4H2,1-2H3.
What are the key properties of 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate?
1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate has a molecular weight of 228.20 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-Dimethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate is sourced from PubChem (CID 54703006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).