C23H35NO2 — CID 5470307
(6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol (PubChem CID 5470307) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol.
| Compound Name | (6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol |
|---|---|
| PubChem CID | 5470307 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol |
| SMILES | CCCC[C@@H](C)/C=C1\CN2CCC[C@H]2[C@@](C)(OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C23H35NO2/c1-4-5-10-18(2)15-20-16-24-14-9-13-21(24)23(3,22(20)25)26-17-19-11-7-6-8-12-19/h6-8,11-12,15,18,21-22,25H,4-5,9-10,13-14,16-17H2,1-3H3/b20-15+/t18-,21+,22-,23-/m1/s1 |
| InChIKey | OQYDSVGYSHAEGF-HZGJPHOCSA-N |
| XLogP | 4.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|