C28H30N4O7 — CID 54703234
(4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(pyridin-2-ylmethylamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54703234) has the molecular formula C28H30N4O7 and a molecular weight of 534.57 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(pyridin-2-ylmethylamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(pyridin-2-ylmethylamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54703234 |
| Molecular Formula | C28H30N4O7 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(pyridin-2-ylmethylamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(CNCc5ccccn5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H30N4O7/c1-32(2)22-17-10-14-9-16-13(11-30-12-15-5-3-4-8-31-15)6-7-18(33)20(16)23(34)19(14)25(36)28(17,39)26(37)21(24(22)35)27(29)38/h3-8,14,17,22,30,33-34,37,39H,9-12H2,1-2H3,(H2,29,38)/t14-,17-,22+,28-/m0/s1 |
| InChIKey | LZPUQLLGVJTODR-KXLQZBQTSA-N |
| XLogP | 0.65 |
| TPSA | 186.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|