C26H32N2O8S — CID 54703276
(4S,5S,6R,12aR)-6-(tert-butylsulfanylmethyl)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54703276) has the molecular formula C26H32N2O8S and a molecular weight of 532.62 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-6-(tert-butylsulfanylmethyl)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-6-(tert-butylsulfanylmethyl)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54703276 |
| Molecular Formula | C26H32N2O8S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (4S,5S,6R,12aR)-6-(tert-butylsulfanylmethyl)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@H](CSC(C)(C)C)C3C(O)C12 |
| InChI | InChI=1S/C26H32N2O8S/c1-25(2,3)37-9-11-10-7-6-8-12(29)13(10)19(30)15-14(11)20(31)17-18(28(4)5)21(32)16(24(27)35)23(34)26(17,36)22(15)33/h6-8,11,14,17-18,20,29-31,34,36H,9H2,1-5H3,(H2,27,35)/t11-,14?,17?,18-,20?,26-/m0/s1 |
| InChIKey | JZEGWEVJSMZTCF-MTNIXORMSA-N |
| XLogP | 1.01 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|