C22H26O6 — CID 5470399
[(1S,2S,4S,6Z,9S,10S)-2,7-dimethyl-5,8,14-trioxo-10-prop-1-en-2-yl-15-oxatricyclo[11.2.1.02,4]hexadeca-6,13(16)-dien-9-yl] acetate (PubChem CID 5470399) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [(1S,2S,4S,6Z,9S,10S)-2,7-dimethyl-5,8,14-trioxo-10-prop-1-en-2-yl-15-oxatricyclo[11.2.1.02,4]hexadeca-6,13(16)-dien-9-yl] acetate.
| Compound Name | [(1S,2S,4S,6Z,9S,10S)-2,7-dimethyl-5,8,14-trioxo-10-prop-1-en-2-yl-15-oxatricyclo[11.2.1.02,4]hexadeca-6,13(16)-dien-9-yl] acetate |
|---|---|
| PubChem CID | 5470399 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(1S,2S,4S,6Z,9S,10S)-2,7-dimethyl-5,8,14-trioxo-10-prop-1-en-2-yl-15-oxatricyclo[11.2.1.02,4]hexadeca-6,13(16)-dien-9-yl] acetate |
| SMILES | C=C(C)[C@@H]1CCC2=C[C@H](OC2=O)[C@@]2(C)C[C@@H]2C(=O)/C=C(/C)C(=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H26O6/c1-11(2)15-7-6-14-9-18(28-21(14)26)22(5)10-16(22)17(24)8-12(3)19(25)20(15)27-13(4)23/h8-9,15-16,18,20H,1,6-7,10H2,2-5H3/b12-8-/t15-,16+,18-,20-,22-/m0/s1 |
| InChIKey | NHVCNLPJSZCWRP-UIOUGSDCSA-N |
| XLogP | 2.87 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|