C23H25N3O9 — CID 54704002
(4S,5S,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54704002) has the molecular formula C23H25N3O9 and a molecular weight of 487.47 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54704002 |
| Molecular Formula | C23H25N3O9 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (4S,5S,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(NC=O)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C23H25N3O9/c1-7-8-4-5-9(25-6-27)16(28)11(8)17(29)12-10(7)18(30)14-15(26(2)3)19(31)13(22(24)34)21(33)23(14,35)20(12)32/h4-7,10,14-15,18,28-30,33,35H,1-3H3,(H2,24,34)(H,25,27)/t7-,10?,14?,15-,18?,23-/m0/s1 |
| InChIKey | BAQMEBMUDMKWDB-NKSKMOEISA-N |
| XLogP | -0.94 |
| TPSA | 210.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|