C27H36NNaO6 — CID 54704131
sodium 2-[3-[(4E,6E,11Z)-13-(3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl)-4,8,12-trimethyltrideca-4,6,11-trienyl]-5-oxo-2H-pyrrol-1-yl]acetate (PubChem CID 54704131) has the molecular formula C27H36NNaO6 and a molecular weight of 493.58 g/mol. Its IUPAC name is sodium 2-[3-[(4E,6E,11Z)-13-(3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl)-4,8,12-trimethyltrideca-4,6,11-trienyl]-5-oxo-2H-pyrrol-1-yl]acetate.
| Compound Name | sodium 2-[3-[(4E,6E,11Z)-13-(3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl)-4,8,12-trimethyltrideca-4,6,11-trienyl]-5-oxo-2H-pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 54704131 |
| Molecular Formula | C27H36NNaO6 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | sodium 2-[3-[(4E,6E,11Z)-13-(3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl)-4,8,12-trimethyltrideca-4,6,11-trienyl]-5-oxo-2H-pyrrol-1-yl]acetate |
| SMILES | CC1=C(O)C(C/C(C)=C\CCC(C)/C=C/C=C(\C)CCCC2=CC(=O)N(CC(=O)[O-])C2)OC1=O.[Na+] |
| InChI | InChI=1S/C27H37NO6.Na/c1-18(10-6-12-20(3)14-23-26(32)21(4)27(33)34-23)8-5-9-19(2)11-7-13-22-15-24(29)28(16-22)17-25(30)31;/h5,8-9,12,15,18,23,32H,6-7,10-11,13-14,16-17H2,1-4H3,(H,30,31);/q;+1/p-1/b8-5+,19-9+,20-12-; |
| InChIKey | RQTYYCGHNHOGFV-RBAXGQKDSA-M |
| XLogP | 0.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|