About S-(diethylamino) N,N-diethylcarbamothioate
S-(diethylamino) N,N-diethylcarbamothioate (PubChem CID 547045) has the molecular formula C9H20N2OS
and a molecular weight of 204.34 g/mol. Its IUPAC name is S-(diethylamino) N,N-diethylcarbamothioate.
Molecular Properties
| Compound Name | S-(diethylamino) N,N-diethylcarbamothioate |
| PubChem CID | 547045 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | S-(diethylamino) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)SC(=O)N(CC)CC |
| InChI | InChI=1S/C9H20N2OS/c1-5-10(6-2)9(12)13-11(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | BVEAVMUSLRMKPZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(diethylamino) N,N-diethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(diethylamino) N,N-diethylcarbamothioate?
The IUPAC name of S-(diethylamino) N,N-diethylcarbamothioate (CID 547045) is S-(diethylamino) N,N-diethylcarbamothioate.
What is the SMILES notation for S-(diethylamino) N,N-diethylcarbamothioate?
The canonical SMILES for S-(diethylamino) N,N-diethylcarbamothioate is CCN(CC)SC(=O)N(CC)CC.
What is the InChIKey of S-(diethylamino) N,N-diethylcarbamothioate?
The InChIKey is BVEAVMUSLRMKPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2OS/c1-5-10(6-2)9(12)13-11(7-3)8-4/h5-8H2,1-4H3.
What are the key properties of S-(diethylamino) N,N-diethylcarbamothioate?
S-(diethylamino) N,N-diethylcarbamothioate has a molecular weight of 204.34 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(diethylamino) N,N-diethylcarbamothioate is sourced from PubChem (CID 547045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).