About (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide
(2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 54704709) has the molecular formula C13H9F3N2O2
and a molecular weight of 282.22 g/mol. Its IUPAC name is (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
Molecular Properties
| Compound Name | (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| PubChem CID | 54704709 |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | C=C/C(O)=C(\C#N)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H9F3N2O2/c1-2-11(19)10(7-17)12(20)18-9-5-3-8(4-6-9)13(14,15)16/h2-6,19H,1H2,(H,18,20)/b11-10- |
| InChIKey | UOMILQYBGRCGMX-KHPPLWFESA-N |
| XLogP | 3.17 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide?
The IUPAC name of (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (CID 54704709) is (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
What is the SMILES notation for (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide?
The canonical SMILES for (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide is C=C/C(O)=C(\C#N)C(=O)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide?
The InChIKey is UOMILQYBGRCGMX-KHPPLWFESA-N. The full InChI is InChI=1S/C13H9F3N2O2/c1-2-11(19)10(7-17)12(20)18-9-5-3-8(4-6-9)13(14,15)16/h2-6,19H,1H2,(H,18,20)/b11-10-.
What are the key properties of (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide?
(2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide has a molecular weight of 282.22 g/mol, XLogP of 3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide is sourced from PubChem (CID 54704709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).