C23H19N4O4S+ — CID 54705210
(E)-1-[3-(4-cyanoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium (PubChem CID 54705210) has the molecular formula C23H19N4O4S+ and a molecular weight of 447.50 g/mol. Its IUPAC name is (E)-1-[3-(4-cyanoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium.
| Compound Name | (E)-1-[3-(4-cyanoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 54705210 |
| Molecular Formula | C23H19N4O4S+ |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (E)-1-[3-(4-cyanoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
| SMILES | CCOC(=O)/C([N+]#N)=C(\O)c1sc(-c2ccc(OC)cc2)cc1Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H18N4O4S/c1-3-31-23(29)20(27-25)21(28)22-18(26-16-8-4-14(13-24)5-9-16)12-19(32-22)15-6-10-17(30-2)11-7-15/h4-12H,3H2,1-2H3,(H-,26,28,29)/p+1 |
| InChIKey | LZOKNGLSHGHSCX-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|