About 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one
2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 54705633) has the molecular formula C22H16ClNO3S
and a molecular weight of 409.89 g/mol. Its IUPAC name is 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| PubChem CID | 54705633 |
| Molecular Formula | C22H16ClNO3S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2sc(Cl)c(C3CC3)c2c(O)c1-c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H16ClNO3S/c23-20-16(12-9-10-12)18-19(25)17(21(26)24-22(18)28-20)13-5-4-8-15(11-13)27-14-6-2-1-3-7-14/h1-8,11-12H,9-10H2,(H2,24,25,26) |
| InChIKey | SZMAZZVZQMTUFJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The IUPAC name of 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (CID 54705633) is 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
What is the SMILES notation for 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The canonical SMILES for 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one is O=c1[nH]c2sc(Cl)c(C3CC3)c2c(O)c1-c1cccc(Oc2ccccc2)c1.
What is the InChIKey of 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
The InChIKey is SZMAZZVZQMTUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClNO3S/c23-20-16(12-9-10-12)18-19(25)17(21(26)24-22(18)28-20)13-5-4-8-15(11-13)27-14-6-2-1-3-7-14/h1-8,11-12H,9-10H2,(H2,24,25,26).
What are the key properties of 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one?
2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one has a molecular weight of 409.89 g/mol, XLogP of 6.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-cyclopropyl-4-hydroxy-5-(3-phenoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one is sourced from PubChem (CID 54705633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).