C24H17N3O6 — CID 54705844
6-hydroxy-11,13-dimethyl-5,9-diphenyl-3-oxa-9,11,13-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),5-triene-4,8,12,14-tetrone (PubChem CID 54705844) has the molecular formula C24H17N3O6 and a molecular weight of 443.42 g/mol. Its IUPAC name is 6-hydroxy-11,13-dimethyl-5,9-diphenyl-3-oxa-9,11,13-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),5-triene-4,8,12,14-tetrone.
| Compound Name | 6-hydroxy-11,13-dimethyl-5,9-diphenyl-3-oxa-9,11,13-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),5-triene-4,8,12,14-tetrone |
|---|---|
| PubChem CID | 54705844 |
| Molecular Formula | C24H17N3O6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 6-hydroxy-11,13-dimethyl-5,9-diphenyl-3-oxa-9,11,13-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),5-triene-4,8,12,14-tetrone |
| SMILES | Cn1c(=O)c2c3oc(=O)c(-c4ccccc4)c(O)c3c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C24H17N3O6/c1-25-20-17(21(29)26(2)24(25)32)19-16(22(30)27(20)14-11-7-4-8-12-14)18(28)15(23(31)33-19)13-9-5-3-6-10-13/h3-12,28H,1-2H3 |
| InChIKey | ANCGSKOQYMRFSH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|