C28H29F6N5O3 — CID 54706529
2-[2-[2,6-bis(2,2,2-trifluoroethyl)-4-pyridinyl]ethyl]-2-cyclopentyl-4-hydroxy-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one (PubChem CID 54706529) has the molecular formula C28H29F6N5O3 and a molecular weight of 597.56 g/mol. Its IUPAC name is 2-[2-[2,6-bis(2,2,2-trifluoroethyl)-4-pyridinyl]ethyl]-2-cyclopentyl-4-hydroxy-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one.
| Compound Name | 2-[2-[2,6-bis(2,2,2-trifluoroethyl)-4-pyridinyl]ethyl]-2-cyclopentyl-4-hydroxy-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one |
|---|---|
| PubChem CID | 54706529 |
| Molecular Formula | C28H29F6N5O3 |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 2-[2-[2,6-bis(2,2,2-trifluoroethyl)-4-pyridinyl]ethyl]-2-cyclopentyl-4-hydroxy-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one |
| SMILES | Cc1cnc2nc(CC3=C(O)CC(CCc4cc(CC(F)(F)F)nc(CC(F)(F)F)c4)(C4CCCC4)OC3=O)nn2c1 |
| InChI | InChI=1S/C28H29F6N5O3/c1-16-14-35-25-37-23(38-39(25)15-16)10-21-22(40)13-26(42-24(21)41,18-4-2-3-5-18)7-6-17-8-19(11-27(29,30)31)36-20(9-17)12-28(32,33)34/h8-9,14-15,18,40H,2-7,10-13H2,1H3 |
| InChIKey | NYHBKPWOGSMOKS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |