C21H34O3 — CID 54706700
4-hydroxy-3,5-dimethyl-6-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]pyran-2-one (PubChem CID 54706700) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-6-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]pyran-2-one.
| Compound Name | 4-hydroxy-3,5-dimethyl-6-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 54706700 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-6-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]pyran-2-one |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)/C=C(\C)c1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C21H34O3/c1-8-9-13(2)10-14(3)11-15(4)12-16(5)20-17(6)19(22)18(7)21(23)24-20/h12-15,22H,8-11H2,1-7H3/b16-12+/t13-,14-,15-/m0/s1 |
| InChIKey | IPVYZLACGWVYRC-IZGRLVBXSA-N |
| XLogP | 5.85 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |