C17H13FN4O3 — CID 54706729
N-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxo-6-pyrimidin-5-yl-1H-pyridine-4-carboxamide (PubChem CID 54706729) has the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxo-6-pyrimidin-5-yl-1H-pyridine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxo-6-pyrimidin-5-yl-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 54706729 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxo-6-pyrimidin-5-yl-1H-pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(-c2cncnc2)[nH]c(=O)c1O |
| InChI | InChI=1S/C17H13FN4O3/c18-12-3-1-10(2-4-12)6-21-16(24)13-5-14(22-17(25)15(13)23)11-7-19-9-20-8-11/h1-5,7-9,23H,6H2,(H,21,24)(H,22,25) |
| InChIKey | DIONQIWUWUGGFH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |