About 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide
4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide (PubChem CID 54706816) has the molecular formula C19H21N3O3
and a molecular weight of 339.39 g/mol. Its IUPAC name is 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide.
Molecular Properties
| Compound Name | 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide |
| PubChem CID | 54706816 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide |
| SMILES | O=c1c([NH+]2CCCCC2)c(O)c2cccnc2n1-c1ccccc1.[OH-] |
| InChI | InChI=1S/C19H19N3O2.H2O/c23-17-15-10-7-11-20-18(15)22(14-8-3-1-4-9-14)19(24)16(17)21-12-5-2-6-13-21;/h1,3-4,7-11,23H,2,5-6,12-13H2;1H2 |
| InChIKey | QREYHPWEHZKOHE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide?
The IUPAC name of 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide (CID 54706816) is 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide.
What is the SMILES notation for 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide?
The canonical SMILES for 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide is O=c1c([NH+]2CCCCC2)c(O)c2cccnc2n1-c1ccccc1.[OH-].
What is the InChIKey of 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide?
The InChIKey is QREYHPWEHZKOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2.H2O/c23-17-15-10-7-11-20-18(15)22(14-8-3-1-4-9-14)19(24)16(17)21-12-5-2-6-13-21;/h1,3-4,7-11,23H,2,5-6,12-13H2;1H2.
What are the key properties of 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide?
4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide has a molecular weight of 339.39 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-phenyl-3-piperidin-1-ium-1-yl-1,8-naphthyridin-2-one hydroxide is sourced from PubChem (CID 54706816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).