C26H19ClN4O4S2 — CID 5470706
3-[1-(1,3-benzothiazol-2-yl)-3-chloro-2-oxo-6-[(E)-2-phenylethenyl]-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid (PubChem CID 5470706) has the molecular formula C26H19ClN4O4S2 and a molecular weight of 551.05 g/mol. Its IUPAC name is 3-[1-(1,3-benzothiazol-2-yl)-3-chloro-2-oxo-6-[(E)-2-phenylethenyl]-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid.
| Compound Name | 3-[1-(1,3-benzothiazol-2-yl)-3-chloro-2-oxo-6-[(E)-2-phenylethenyl]-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 5470706 |
| Molecular Formula | C26H19ClN4O4S2 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 3-[1-(1,3-benzothiazol-2-yl)-3-chloro-2-oxo-6-[(E)-2-phenylethenyl]-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid |
| SMILES | O=C1C(Cl)C2(CC(/C=C/c3ccccc3)=NN2c2cccc(S(=O)(=O)O)c2)N1c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H19ClN4O4S2/c27-23-24(32)30(25-28-21-11-4-5-12-22(21)36-25)26(23)16-18(14-13-17-7-2-1-3-8-17)29-31(26)19-9-6-10-20(15-19)37(33,34)35/h1-15,23H,16H2,(H,33,34,35)/b14-13+ |
| InChIKey | ATBZTJLBWDORJQ-BUHFOSPRSA-N |
| XLogP | 5.17 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|