C30H28ClN5O4S2 — CID 5470709
3-[1-(1,3-benzothiazol-2-yl)-3-chloro-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-2-oxo-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid (PubChem CID 5470709) has the molecular formula C30H28ClN5O4S2 and a molecular weight of 622.17 g/mol. Its IUPAC name is 3-[1-(1,3-benzothiazol-2-yl)-3-chloro-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-2-oxo-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid.
| Compound Name | 3-[1-(1,3-benzothiazol-2-yl)-3-chloro-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-2-oxo-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 5470709 |
| Molecular Formula | C30H28ClN5O4S2 |
| Molecular Weight | 622.17 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 3-[1-(1,3-benzothiazol-2-yl)-3-chloro-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-2-oxo-1,7,8-triazaspiro[3.4]oct-6-en-8-yl]benzenesulfonic acid |
| SMILES | CCN(CC)c1ccc(/C=C/C2=NN(c3cccc(S(=O)(=O)O)c3)C3(C2)C(Cl)C(=O)N3c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C30H28ClN5O4S2/c1-3-34(4-2)22-16-13-20(14-17-22)12-15-21-19-30(36(33-21)23-8-7-9-24(18-23)42(38,39)40)27(31)28(37)35(30)29-32-25-10-5-6-11-26(25)41-29/h5-18,27H,3-4,19H2,1-2H3,(H,38,39,40)/b15-12+ |
| InChIKey | GJRHITRDRUDSJP-NTCAYCPXSA-N |
| XLogP | 6.02 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.17 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|