About 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one
3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one (PubChem CID 54707125) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 54707125 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one |
| SMILES | O=C1NCC(O)=C1c1ccccc1 |
| InChI | InChI=1S/C10H9NO2/c12-8-6-11-10(13)9(8)7-4-2-1-3-5-7/h1-5,12H,6H2,(H,11,13) |
| InChIKey | JCJVLKOEGYMNTP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one (CID 54707125) is 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one is O=C1NCC(O)=C1c1ccccc1.
What is the InChIKey of 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one?
The InChIKey is JCJVLKOEGYMNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-8-6-11-10(13)9(8)7-4-2-1-3-5-7/h1-5,12H,6H2,(H,11,13).
What are the key properties of 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one?
3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one has a molecular weight of 175.19 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-phenyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 54707125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).