About 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal
2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal (PubChem CID 54707144) has the molecular formula C24H40O4
and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal.
Molecular Properties
| Compound Name | 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal |
| PubChem CID | 54707144 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal |
| SMILES | CCCCCC(C=O)(CCCC)c1oc(=O)c(CCCC)c(O)c1CCCC |
| InChI | InChI=1S/C24H40O4/c1-5-9-13-17-24(18-25,16-12-8-4)22-19(14-10-6-2)21(26)20(15-11-7-3)23(27)28-22/h18,26H,5-17H2,1-4H3 |
| InChIKey | BHILJTVUGNIZMP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal?
The IUPAC name of 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal (CID 54707144) is 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal.
What is the SMILES notation for 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal?
The canonical SMILES for 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal is CCCCCC(C=O)(CCCC)c1oc(=O)c(CCCC)c(O)c1CCCC.
What is the InChIKey of 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal?
The InChIKey is BHILJTVUGNIZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40O4/c1-5-9-13-17-24(18-25,16-12-8-4)22-19(14-10-6-2)21(26)20(15-11-7-3)23(27)28-22/h18,26H,5-17H2,1-4H3.
What are the key properties of 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal?
2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal has a molecular weight of 392.58 g/mol, XLogP of 6.24, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-(3,5-dibutyl-4-hydroxy-6-oxopyran-2-yl)heptanal is sourced from PubChem (CID 54707144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).