C34H46AlN2O43S8 — CID 54707457
CID 54707457 (PubChem CID 54707457) has the molecular formula C34H46AlN2O43S8 and a molecular weight of 1454.23 g/mol.
| Compound Name | CID 54707457 |
|---|---|
| PubChem CID | 54707457 |
| Molecular Formula | C34H46AlN2O43S8 |
| Molecular Weight | 1454.23 g/mol |
| Exact Mass | 1452.91 |
| IUPAC Name | — |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@@H]12.O=S(=O)(O)OC[C@H]1O[C@@](COS(=O)(=O)O)(O[C@H]2O[C@H](COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H]2OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@@H]1OS(=O)(=O)O.[Al] |
| InChI | InChI=1S/C22H24N2O8.C12H22O35S8.Al/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28;13-48(14,15)37-1-4-6(43-51(22,23)24)8(45-53(28,29)30)9(46-54(31,32)33)11(40-4)42-12(3-39-50(19,20)21)10(47-55(34,35)36)7(44-52(25,26)27)5(41-12)2-38-49(16,17)18;/h4-6,9-10,15,25-26,29,31-32H,7H2,1-3H3,(H2,23,30);4-11H,1-3H2,(H,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30)(H,31,32,33)(H,34,35,36);/t9-,10-,15-,21+,22-;4-,5-,6-,7-,8+,9-,10+,11-,12+;/m01./s1 |
| InChIKey | OAFNAJKWSXNHPS-SBFLXQKOSA-N |
| XLogP | -7.53 |
| TPSA | 718.11 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 36 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1454.23 |
| LogP ≤ 5 | -7.53 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 36 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|