About (E)-N,N-diethyl-3-hydroxybut-2-enamide
(E)-N,N-diethyl-3-hydroxybut-2-enamide (PubChem CID 54707515) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-hydroxybut-2-enamide.
Molecular Properties
| Compound Name | (E)-N,N-diethyl-3-hydroxybut-2-enamide |
| PubChem CID | 54707515 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (E)-N,N-diethyl-3-hydroxybut-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C(\C)O |
| InChI | InChI=1S/C8H15NO2/c1-4-9(5-2)8(11)6-7(3)10/h6,10H,4-5H2,1-3H3/b7-6+ |
| InChIKey | HFULVRQKWHMTMH-VOTSOKGWSA-N |
| XLogP | 1.32 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-diethyl-3-hydroxybut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-diethyl-3-hydroxybut-2-enamide?
The IUPAC name of (E)-N,N-diethyl-3-hydroxybut-2-enamide (CID 54707515) is (E)-N,N-diethyl-3-hydroxybut-2-enamide.
What is the SMILES notation for (E)-N,N-diethyl-3-hydroxybut-2-enamide?
The canonical SMILES for (E)-N,N-diethyl-3-hydroxybut-2-enamide is CCN(CC)C(=O)/C=C(\C)O.
What is the InChIKey of (E)-N,N-diethyl-3-hydroxybut-2-enamide?
The InChIKey is HFULVRQKWHMTMH-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H15NO2/c1-4-9(5-2)8(11)6-7(3)10/h6,10H,4-5H2,1-3H3/b7-6+.
What are the key properties of (E)-N,N-diethyl-3-hydroxybut-2-enamide?
(E)-N,N-diethyl-3-hydroxybut-2-enamide has a molecular weight of 157.21 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-diethyl-3-hydroxybut-2-enamide is sourced from PubChem (CID 54707515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).