C21H28O9 — CID 54707719
3-O,6-O-diethyl 1-O,4-O-dimethyl 2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 54707719) has the molecular formula C21H28O9 and a molecular weight of 424.45 g/mol. Its IUPAC name is 3-O,6-O-diethyl 1-O,4-O-dimethyl 2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | 3-O,6-O-diethyl 1-O,4-O-dimethyl 2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 54707719 |
| Molecular Formula | C21H28O9 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-O,6-O-diethyl 1-O,4-O-dimethyl 2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C)C(C(=O)OC)C2(C)C(C(=O)OCC)=C(O)C(C(=O)OC)C12C |
| InChI | InChI=1S/C21H28O9/c1-8-29-18(25)12-10(3)11(16(23)27-6)20(4)14(19(26)30-9-2)15(22)13(17(24)28-7)21(12,20)5/h11,13,22H,8-9H2,1-7H3 |
| InChIKey | VFEPAWLUHVWSIP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|