About 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one
5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one (PubChem CID 54708211) has the molecular formula C27H19ClO4
and a molecular weight of 442.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one |
| PubChem CID | 54708211 |
| Molecular Formula | C27H19ClO4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one |
| SMILES | Cc1cc(-c2ccc(C3(c4ccc(Cl)cc4)OC(=O)C(O)=C3O)cc2)c2ccccc2c1 |
| InChI | InChI=1S/C27H19ClO4/c1-16-14-18-4-2-3-5-22(18)23(15-16)17-6-8-19(9-7-17)27(20-10-12-21(28)13-11-20)25(30)24(29)26(31)32-27/h2-15,29-30H,1H3 |
| InChIKey | XCNDJSCKGCIZCO-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one?
The IUPAC name of 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one (CID 54708211) is 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one.
What is the SMILES notation for 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one?
The canonical SMILES for 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one is Cc1cc(-c2ccc(C3(c4ccc(Cl)cc4)OC(=O)C(O)=C3O)cc2)c2ccccc2c1.
What is the InChIKey of 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one?
The InChIKey is XCNDJSCKGCIZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19ClO4/c1-16-14-18-4-2-3-5-22(18)23(15-16)17-6-8-19(9-7-17)27(20-10-12-21(28)13-11-20)25(30)24(29)26(31)32-27/h2-15,29-30H,1H3.
What are the key properties of 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one?
5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one has a molecular weight of 442.90 g/mol, XLogP of 6.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3,4-dihydroxy-5-[4-(3-methylnaphthalen-1-yl)phenyl]furan-2-one is sourced from PubChem (CID 54708211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).