C22H25ClN2O7 — CID 54708235
(4S,4aS,5aS,6S,11R,12aR)-11-chloro-4-(dimethylamino)-1,6,10,12,12a-pentahydroxy-6-methyl-3-oxo-4a,5,5a,11-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54708235) has the molecular formula C22H25ClN2O7 and a molecular weight of 464.90 g/mol. Its IUPAC name is (4S,4aS,5aS,6S,11R,12aR)-11-chloro-4-(dimethylamino)-1,6,10,12,12a-pentahydroxy-6-methyl-3-oxo-4a,5,5a,11-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,6S,11R,12aR)-11-chloro-4-(dimethylamino)-1,6,10,12,12a-pentahydroxy-6-methyl-3-oxo-4a,5,5a,11-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54708235 |
| Molecular Formula | C22H25ClN2O7 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (4S,4aS,5aS,6S,11R,12aR)-11-chloro-4-(dimethylamino)-1,6,10,12,12a-pentahydroxy-6-methyl-3-oxo-4a,5,5a,11-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(O)=C3[C@@H](Cl)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H25ClN2O7/c1-21(31)8-5-4-6-11(26)12(8)15(23)13-9(21)7-10-16(25(2)3)17(27)14(20(24)30)19(29)22(10,32)18(13)28/h4-6,9-10,15-16,26,28-29,31-32H,7H2,1-3H3,(H2,24,30)/t9-,10-,15-,16-,21+,22-/m0/s1 |
| InChIKey | NXSRXNNVLGEGOV-YJCFMPFXSA-N |
| XLogP | 0.88 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|