C14H15N5O2S2 — CID 54708662
3-amino-1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-hydroxy-5,5-dimethylpyrrol-2-one (PubChem CID 54708662) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-amino-1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-hydroxy-5,5-dimethylpyrrol-2-one.
| Compound Name | 3-amino-1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-hydroxy-5,5-dimethylpyrrol-2-one |
|---|---|
| PubChem CID | 54708662 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-amino-1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4-hydroxy-5,5-dimethylpyrrol-2-one |
| SMILES | CC1(C)C(O)=C(N)C(=O)N1c1ccc(-n2c(=S)[nH][nH]c2=S)cc1 |
| InChI | InChI=1S/C14H15N5O2S2/c1-14(2)10(20)9(15)11(21)19(14)8-5-3-7(4-6-8)18-12(22)16-17-13(18)23/h3-6,20H,15H2,1-2H3,(H,16,22)(H,17,23) |
| InChIKey | WEKFKPOGSHDFCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|